C9H9ClN6 — CID 1492761
3-N-(3-chlorophenyl)-1,2,4-triazine-3,5,6-triamine (PubChem CID 1492761) has the molecular formula C9H9ClN6 and a molecular weight of 236.67 g/mol. Its IUPAC name is 3-N-(3-chlorophenyl)-1,2,4-triazine-3,5,6-triamine.
| Compound Name | 3-N-(3-chlorophenyl)-1,2,4-triazine-3,5,6-triamine |
|---|---|
| PubChem CID | 1492761 |
| Molecular Formula | C9H9ClN6 |
| Molecular Weight | 236.67 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3-N-(3-chlorophenyl)-1,2,4-triazine-3,5,6-triamine |
| SMILES | Nc1nnc(Nc2cccc(Cl)c2)nc1N |
| InChI | InChI=1S/C9H9ClN6/c10-5-2-1-3-6(4-5)13-9-14-7(11)8(12)15-16-9/h1-4H,(H2,12,15)(H3,11,13,14,16) |
| InChIKey | DJNMRTGUKITEIT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.67 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|