C13H13Cl2N3O — CID 136972081
5-chloro-4-[3-(3-chloropropyl)anilino]-1H-pyrimidin-6-one (PubChem CID 136972081) has the molecular formula C13H13Cl2N3O and a molecular weight of 298.17 g/mol. Its IUPAC name is 5-chloro-4-[3-(3-chloropropyl)anilino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[3-(3-chloropropyl)anilino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136972081 |
| Molecular Formula | C13H13Cl2N3O |
| Molecular Weight | 298.17 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 5-chloro-4-[3-(3-chloropropyl)anilino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(Nc2cccc(CCCCl)c2)c1Cl |
| InChI | InChI=1S/C13H13Cl2N3O/c14-6-2-4-9-3-1-5-10(7-9)18-12-11(15)13(19)17-8-16-12/h1,3,5,7-8H,2,4,6H2,(H2,16,17,18,19) |
| InChIKey | PNDAJCCDHWPPTE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|