C25H26N2O3 — CID 139801198
2-[(2-anilino-4-pentylbenzoyl)amino]benzoic acid (PubChem CID 139801198) has the molecular formula C25H26N2O3 and a molecular weight of 402.49 g/mol. Its IUPAC name is 2-[(2-anilino-4-pentylbenzoyl)amino]benzoic acid.
| Compound Name | 2-[(2-anilino-4-pentylbenzoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 139801198 |
| Molecular Formula | C25H26N2O3 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-[(2-anilino-4-pentylbenzoyl)amino]benzoic acid |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccccc2C(=O)O)c(Nc2ccccc2)c1 |
| InChI | InChI=1S/C25H26N2O3/c1-2-3-5-10-18-15-16-20(23(17-18)26-19-11-6-4-7-12-19)24(28)27-22-14-9-8-13-21(22)25(29)30/h4,6-9,11-17,26H,2-3,5,10H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | YYOPMIDNYYXMLC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|