C19H21N3O2 — CID 169383937
1-[4-[(phenylhydrazinylidene)methyl]phenyl]piperidine-4-carboxylic acid (PubChem CID 169383937) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-[4-[(phenylhydrazinylidene)methyl]phenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[4-[(phenylhydrazinylidene)methyl]phenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 169383937 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[4-[(phenylhydrazinylidene)methyl]phenyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ccc(C=NNc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C19H21N3O2/c23-19(24)16-10-12-22(13-11-16)18-8-6-15(7-9-18)14-20-21-17-4-2-1-3-5-17/h1-9,14,16,21H,10-13H2,(H,23,24) |
| InChIKey | MGSWKJCPNLQPDA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|