C17H21F3N2O2 — CID 95990939
(3S)-3-morpholin-4-yl-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-2-one (PubChem CID 95990939) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is (3S)-3-morpholin-4-yl-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-2-one.
| Compound Name | (3S)-3-morpholin-4-yl-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-2-one |
|---|---|
| PubChem CID | 95990939 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (3S)-3-morpholin-4-yl-1-[[2-(trifluoromethyl)phenyl]methyl]piperidin-2-one |
| SMILES | O=C1[C@@H](N2CCOCC2)CCCN1Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O2/c18-17(19,20)14-5-2-1-4-13(14)12-22-7-3-6-15(16(22)23)21-8-10-24-11-9-21/h1-2,4-5,15H,3,6-12H2/t15-/m0/s1 |
| InChIKey | FQIBJMSPFQKZRI-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |