C13H12F3NO2 — CID 79517938
1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2,4-dione (PubChem CID 79517938) has the molecular formula C13H12F3NO2 and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2,4-dione.
| Compound Name | 1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2,4-dione |
|---|---|
| PubChem CID | 79517938 |
| Molecular Formula | C13H12F3NO2 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 1-[[2-(trifluoromethyl)phenyl]methyl]piperidine-2,4-dione |
| SMILES | O=C1CCN(Cc2ccccc2C(F)(F)F)C(=O)C1 |
| InChI | InChI=1S/C13H12F3NO2/c14-13(15,16)11-4-2-1-3-9(11)8-17-6-5-10(18)7-12(17)19/h1-4H,5-8H2 |
| InChIKey | MTXRCYJIDYIZPV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|