C22H26F3N3O — CID 26337012
1-[[4-(dimethylamino)phenyl]methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-5-one (PubChem CID 26337012) has the molecular formula C22H26F3N3O and a molecular weight of 405.46 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-5-one.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 26337012 |
| Molecular Formula | C22H26F3N3O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-4-[[2-(trifluoromethyl)phenyl]methyl]-1,4-diazepan-5-one |
| SMILES | CN(C)c1ccc(CN2CCC(=O)N(Cc3ccccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C22H26F3N3O/c1-26(2)19-9-7-17(8-10-19)15-27-12-11-21(29)28(14-13-27)16-18-5-3-4-6-20(18)22(23,24)25/h3-10H,11-16H2,1-2H3 |
| InChIKey | BLVXUJDFFNVLEV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|