C10H17N5O — CID 103805775
N-[(1R,2R)-2-aminocyclohexyl]-2-(triazol-1-yl)acetamide (PubChem CID 103805775) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-2-(triazol-1-yl)acetamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 103805775 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-2-(triazol-1-yl)acetamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)Cn1ccnn1 |
| InChI | InChI=1S/C10H17N5O/c11-8-3-1-2-4-9(8)13-10(16)7-15-6-5-12-14-15/h5-6,8-9H,1-4,7,11H2,(H,13,16)/t8-,9-/m1/s1 |
| InChIKey | YWDVWFHSCUNJTH-RKDXNWHRSA-N |
| XLogP | -0.34 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |