C9H11N5O3 — CID 113276448
N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide (PubChem CID 113276448) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide.
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 113276448 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide |
| SMILES | O=C1CCC(NC(=O)Cn2ccnn2)C(=O)N1 |
| InChI | InChI=1S/C9H11N5O3/c15-7-2-1-6(9(17)12-7)11-8(16)5-14-4-3-10-13-14/h3-4,6H,1-2,5H2,(H,11,16)(H,12,15,17) |
| InChIKey | NTZUDFCTYPAUKH-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|