About N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide
N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide (PubChem CID 113276448) has the molecular formula C9H11N5O3
and a molecular weight of 237.22 g/mol. Its IUPAC name is N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide |
| PubChem CID | 113276448 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide |
| SMILES | O=C1CCC(NC(=O)Cn2ccnn2)C(=O)N1 |
| InChI | InChI=1S/C9H11N5O3/c15-7-2-1-6(9(17)12-7)11-8(16)5-14-4-3-10-13-14/h3-4,6H,1-2,5H2,(H,11,16)(H,12,15,17) |
| InChIKey | NTZUDFCTYPAUKH-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide?
The IUPAC name of N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide (CID 113276448) is N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide.
What is the SMILES notation for N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide?
The canonical SMILES for N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide is O=C1CCC(NC(=O)Cn2ccnn2)C(=O)N1.
What is the InChIKey of N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide?
The InChIKey is NTZUDFCTYPAUKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O3/c15-7-2-1-6(9(17)12-7)11-8(16)5-14-4-3-10-13-14/h3-4,6H,1-2,5H2,(H,11,16)(H,12,15,17).
What are the key properties of N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide?
N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide has a molecular weight of 237.22 g/mol, XLogP of -1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,6-dioxopiperidin-3-yl)-2-(triazol-1-yl)acetamide is sourced from PubChem (CID 113276448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).