C19H27FN2O2 — CID 40640694
N'-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-N-[(4-fluorophenyl)methyl]butanediamide (PubChem CID 40640694) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is N'-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-N-[(4-fluorophenyl)methyl]butanediamide.
| Compound Name | N'-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-N-[(4-fluorophenyl)methyl]butanediamide |
|---|---|
| PubChem CID | 40640694 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N'-[(1R,2R,3R)-2,3-dimethylcyclohexyl]-N-[(4-fluorophenyl)methyl]butanediamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)CCC(=O)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H27FN2O2/c1-13-4-3-5-17(14(13)2)22-19(24)11-10-18(23)21-12-15-6-8-16(20)9-7-15/h6-9,13-14,17H,3-5,10-12H2,1-2H3,(H,21,23)(H,22,24)/t13-,14-,17-/m1/s1 |
| InChIKey | KLMMRKLJWSKXBR-CKEIUWERSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |