C17H27N3O3 — CID 133267954
N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-4-(1H-pyrazol-4-yl)butanamide (PubChem CID 133267954) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-4-(1H-pyrazol-4-yl)butanamide.
| Compound Name | N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-4-(1H-pyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 133267954 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-4-(1H-pyrazol-4-yl)butanamide |
| SMILES | O=C(CCCc1cn[nH]c1)N[C@@H]1CCOC[C@@H]1C1CCOCC1 |
| InChI | InChI=1S/C17H27N3O3/c21-17(3-1-2-13-10-18-19-11-13)20-16-6-9-23-12-15(16)14-4-7-22-8-5-14/h10-11,14-16H,1-9,12H2,(H,18,19)(H,20,21)/t15-,16-/m1/s1 |
| InChIKey | SFFRLJVHSWEFAB-HZPDHXFCSA-N |
| XLogP | 1.68 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |