C17H25N3O3 — CID 91795988
2,6-dimethyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]pyrimidine-4-carboxamide (PubChem CID 91795988) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 2,6-dimethyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]pyrimidine-4-carboxamide.
| Compound Name | 2,6-dimethyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 91795988 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 2,6-dimethyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]pyrimidine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N[C@H]2CCOC[C@H]2C2CCOCC2)nc(C)n1 |
| InChI | InChI=1S/C17H25N3O3/c1-11-9-16(19-12(2)18-11)17(21)20-15-5-8-23-10-14(15)13-3-6-22-7-4-13/h9,13-15H,3-8,10H2,1-2H3,(H,20,21)/t14-,15-/m0/s1 |
| InChIKey | CWSXVNOWKZYICJ-GJZGRUSLSA-N |
| XLogP | 1.65 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |