C18H25NO5 — CID 133265575
3-hydroxy-4-methoxy-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]benzamide (PubChem CID 133265575) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 3-hydroxy-4-methoxy-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]benzamide.
| Compound Name | 3-hydroxy-4-methoxy-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 133265575 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-hydroxy-4-methoxy-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CCOC[C@@H]2C2CCOCC2)cc1O |
| InChI | InChI=1S/C18H25NO5/c1-22-17-3-2-13(10-16(17)20)18(21)19-15-6-9-24-11-14(15)12-4-7-23-8-5-12/h2-3,10,12,14-15,20H,4-9,11H2,1H3,(H,19,21)/t14-,15-/m1/s1 |
| InChIKey | YFWCTHGEEUXKFU-HUUCEWRRSA-N |
| XLogP | 1.96 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |