C19H27NO5 — CID 91794863
2,4-dimethoxy-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]benzamide (PubChem CID 91794863) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]benzamide.
| Compound Name | 2,4-dimethoxy-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]benzamide |
|---|---|
| PubChem CID | 91794863 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2,4-dimethoxy-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H]2CCOC[C@H]2C2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C19H27NO5/c1-22-14-3-4-15(18(11-14)23-2)19(21)20-17-7-10-25-12-16(17)13-5-8-24-9-6-13/h3-4,11,13,16-17H,5-10,12H2,1-2H3,(H,20,21)/t16-,17-/m0/s1 |
| InChIKey | YVIZSBHBEZBVND-IRXDYDNUSA-N |
| XLogP | 2.27 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |