C13H16ClNO4 — CID 91777707
4-chloro-N-[(3S,4R)-3-hydroxyoxan-4-yl]-2-methoxybenzamide (PubChem CID 91777707) has the molecular formula C13H16ClNO4 and a molecular weight of 285.73 g/mol. Its IUPAC name is 4-chloro-N-[(3S,4R)-3-hydroxyoxan-4-yl]-2-methoxybenzamide.
| Compound Name | 4-chloro-N-[(3S,4R)-3-hydroxyoxan-4-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 91777707 |
| Molecular Formula | C13H16ClNO4 |
| Molecular Weight | 285.73 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-chloro-N-[(3S,4R)-3-hydroxyoxan-4-yl]-2-methoxybenzamide |
| SMILES | COc1cc(Cl)ccc1C(=O)N[C@@H]1CCOC[C@H]1O |
| InChI | InChI=1S/C13H16ClNO4/c1-18-12-6-8(14)2-3-9(12)13(17)15-10-4-5-19-7-11(10)16/h2-3,6,10-11,16H,4-5,7H2,1H3,(H,15,17)/t10-,11-/m1/s1 |
| InChIKey | HQWGDALKOGWYEG-GHMZBOCLSA-N |
| XLogP | 1.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.73 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |