C15H19ClN2O4 — CID 91836572
N-[(3R,4R)-1-acetyl-3-hydroxypiperidin-4-yl]-4-chloro-2-methoxybenzamide (PubChem CID 91836572) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is N-[(3R,4R)-1-acetyl-3-hydroxypiperidin-4-yl]-4-chloro-2-methoxybenzamide.
| Compound Name | N-[(3R,4R)-1-acetyl-3-hydroxypiperidin-4-yl]-4-chloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 91836572 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[(3R,4R)-1-acetyl-3-hydroxypiperidin-4-yl]-4-chloro-2-methoxybenzamide |
| SMILES | COc1cc(Cl)ccc1C(=O)N[C@@H]1CCN(C(C)=O)C[C@H]1O |
| InChI | InChI=1S/C15H19ClN2O4/c1-9(19)18-6-5-12(13(20)8-18)17-15(21)11-4-3-10(16)7-14(11)22-2/h3-4,7,12-13,20H,5-6,8H2,1-2H3,(H,17,21)/t12-,13-/m1/s1 |
| InChIKey | MFJIFOPCXBMEFQ-CHWSQXEVSA-N |
| XLogP | 1.06 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |