C21H25NO3 — CID 133265512
N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]naphthalene-2-carboxamide (PubChem CID 133265512) has the molecular formula C21H25NO3 and a molecular weight of 339.43 g/mol. Its IUPAC name is N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]naphthalene-2-carboxamide.
| Compound Name | N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 133265512 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]naphthalene-2-carboxamide |
| SMILES | O=C(N[C@@H]1CCOC[C@@H]1C1CCOCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H25NO3/c23-21(18-6-5-15-3-1-2-4-17(15)13-18)22-20-9-12-25-14-19(20)16-7-10-24-11-8-16/h1-6,13,16,19-20H,7-12,14H2,(H,22,23)/t19-,20-/m1/s1 |
| InChIKey | BUWJXJIDUZGTNQ-WOJBJXKFSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |