C20H25NO4 — CID 91776897
2-methyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]-1-benzofuran-7-carboxamide (PubChem CID 91776897) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-methyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]-1-benzofuran-7-carboxamide.
| Compound Name | 2-methyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]-1-benzofuran-7-carboxamide |
|---|---|
| PubChem CID | 91776897 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-methyl-N-[(3S,4S)-3-(oxan-4-yl)oxan-4-yl]-1-benzofuran-7-carboxamide |
| SMILES | Cc1cc2cccc(C(=O)N[C@H]3CCOC[C@H]3C3CCOCC3)c2o1 |
| InChI | InChI=1S/C20H25NO4/c1-13-11-15-3-2-4-16(19(15)25-13)20(22)21-18-7-10-24-12-17(18)14-5-8-23-9-6-14/h2-4,11,14,17-18H,5-10,12H2,1H3,(H,21,22)/t17-,18-/m0/s1 |
| InChIKey | JZXKDEWEQWIPHQ-ROUUACIJSA-N |
| XLogP | 3.30 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |