C14H22N4O3 — CID 133266154
5-methyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2H-triazole-4-carboxamide (PubChem CID 133266154) has the molecular formula C14H22N4O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-methyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2H-triazole-4-carboxamide.
| Compound Name | 5-methyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 133266154 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-methyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2H-triazole-4-carboxamide |
| SMILES | Cc1n[nH]nc1C(=O)N[C@@H]1CCOC[C@@H]1C1CCOCC1 |
| InChI | InChI=1S/C14H22N4O3/c1-9-13(17-18-16-9)14(19)15-12-4-7-21-8-11(12)10-2-5-20-6-3-10/h10-12H,2-8H2,1H3,(H,15,19)(H,16,17,18)/t11-,12-/m1/s1 |
| InChIKey | PZBMYVQJUIBPAA-VXGBXAGGSA-N |
| XLogP | 0.67 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |