C19H27NO5S — CID 133267554
2-(4-methylsulfonylphenyl)-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]acetamide (PubChem CID 133267554) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is 2-(4-methylsulfonylphenyl)-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]acetamide.
| Compound Name | 2-(4-methylsulfonylphenyl)-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]acetamide |
|---|---|
| PubChem CID | 133267554 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-(4-methylsulfonylphenyl)-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]acetamide |
| SMILES | CS(=O)(=O)c1ccc(CC(=O)N[C@@H]2CCOC[C@@H]2C2CCOCC2)cc1 |
| InChI | InChI=1S/C19H27NO5S/c1-26(22,23)16-4-2-14(3-5-16)12-19(21)20-18-8-11-25-13-17(18)15-6-9-24-10-7-15/h2-5,15,17-18H,6-13H2,1H3,(H,20,21)/t17-,18-/m1/s1 |
| InChIKey | LQTDXQBUMXTQGM-QZTJIDSGSA-N |
| XLogP | 1.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |