About 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide
5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide (PubChem CID 133265741) has the molecular formula C17H26N2O3
and a molecular weight of 306.41 g/mol. Its IUPAC name is 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide.
Molecular Properties
| Compound Name | 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide |
| PubChem CID | 133265741 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide |
| SMILES | CCc1ccc(C(=O)N[C@@H]2CCOC[C@@H]2C2CCOCC2)[nH]1 |
| InChI | InChI=1S/C17H26N2O3/c1-2-13-3-4-16(18-13)17(20)19-15-7-10-22-11-14(15)12-5-8-21-9-6-12/h3-4,12,14-15,18H,2,5-11H2,1H3,(H,19,20)/t14-,15-/m1/s1 |
| InChIKey | RIDIASIPSZQZNJ-HUUCEWRRSA-N |
| XLogP | 2.14 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide?
The IUPAC name of 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide (CID 133265741) is 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide.
What is the SMILES notation for 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide?
The canonical SMILES for 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide is CCc1ccc(C(=O)N[C@@H]2CCOC[C@@H]2C2CCOCC2)[nH]1.
What is the InChIKey of 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide?
The InChIKey is RIDIASIPSZQZNJ-HUUCEWRRSA-N. The full InChI is InChI=1S/C17H26N2O3/c1-2-13-3-4-16(18-13)17(20)19-15-7-10-22-11-14(15)12-5-8-21-9-6-12/h3-4,12,14-15,18H,2,5-11H2,1H3,(H,19,20)/t14-,15-/m1/s1.
What are the key properties of 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide?
5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide has a molecular weight of 306.41 g/mol, XLogP of 2.14, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-1H-pyrrole-2-carboxamide is sourced from PubChem (CID 133265741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).