C17H24N2O3 — CID 133267139
N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2-pyridin-3-ylacetamide (PubChem CID 133267139) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2-pyridin-3-ylacetamide.
| Compound Name | N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 133267139 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N-[(3R,4R)-3-(oxan-4-yl)oxan-4-yl]-2-pyridin-3-ylacetamide |
| SMILES | O=C(Cc1cccnc1)N[C@@H]1CCOC[C@@H]1C1CCOCC1 |
| InChI | InChI=1S/C17H24N2O3/c20-17(10-13-2-1-6-18-11-13)19-16-5-9-22-12-15(16)14-3-7-21-8-4-14/h1-2,6,11,14-16H,3-5,7-10,12H2,(H,19,20)/t15-,16-/m1/s1 |
| InChIKey | PHEFFINQLFXSAS-HZPDHXFCSA-N |
| XLogP | 1.57 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |