C13H16FNO4 — CID 155996080
N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-2-(4-fluorophenyl)acetamide (PubChem CID 155996080) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 155996080 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)N[C@@H]1COC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16FNO4/c14-9-3-1-8(2-4-9)5-12(17)15-10-6-19-7-11(16)13(10)18/h1-4,10-11,13,16,18H,5-7H2,(H,15,17)/t10-,11-,13+/m1/s1 |
| InChIKey | USIBXFDEDQWCOO-WZRBSPASSA-N |
| XLogP | -0.40 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |