C11H14FNO2 — CID 93384215
(3S,4R)-4-[(4-fluorophenyl)methylamino]oxolan-3-ol (PubChem CID 93384215) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is (3S,4R)-4-[(4-fluorophenyl)methylamino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[(4-fluorophenyl)methylamino]oxolan-3-ol |
|---|---|
| PubChem CID | 93384215 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (3S,4R)-4-[(4-fluorophenyl)methylamino]oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2/c12-9-3-1-8(2-4-9)5-13-10-6-15-7-11(10)14/h1-4,10-11,13-14H,5-7H2/t10-,11-/m1/s1 |
| InChIKey | WJZPHIDOFXUGAF-GHMZBOCLSA-N |
| XLogP | 0.68 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |