C8H13N3O2 — CID 130680255
(3S,4R)-4-(1H-pyrazol-5-ylmethylamino)oxolan-3-ol (PubChem CID 130680255) has the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. Its IUPAC name is (3S,4R)-4-(1H-pyrazol-5-ylmethylamino)oxolan-3-ol.
| Compound Name | (3S,4R)-4-(1H-pyrazol-5-ylmethylamino)oxolan-3-ol |
|---|---|
| PubChem CID | 130680255 |
| Molecular Formula | C8H13N3O2 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | (3S,4R)-4-(1H-pyrazol-5-ylmethylamino)oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1NCc1ccn[nH]1 |
| InChI | InChI=1S/C8H13N3O2/c12-8-5-13-4-7(8)9-3-6-1-2-10-11-6/h1-2,7-9,12H,3-5H2,(H,10,11)/t7-,8-/m1/s1 |
| InChIKey | VYFJYSQFGWVOAR-HTQZYQBOSA-N |
| XLogP | -0.74 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |