C9H15N3S — CID 102671469
2-methyl-N-(1H-pyrazol-5-ylmethyl)thiolan-3-amine (PubChem CID 102671469) has the molecular formula C9H15N3S and a molecular weight of 197.31 g/mol. Its IUPAC name is 2-methyl-N-(1H-pyrazol-5-ylmethyl)thiolan-3-amine.
| Compound Name | 2-methyl-N-(1H-pyrazol-5-ylmethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 102671469 |
| Molecular Formula | C9H15N3S |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-methyl-N-(1H-pyrazol-5-ylmethyl)thiolan-3-amine |
| SMILES | CC1SCCC1NCc1ccn[nH]1 |
| InChI | InChI=1S/C9H15N3S/c1-7-9(3-5-13-7)10-6-8-2-4-11-12-8/h2,4,7,9-10H,3,5-6H2,1H3,(H,11,12) |
| InChIKey | MKVPUKJTVCUWKE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |