C10H14N2O2 — CID 93384643
(3S,4R)-4-(pyridin-4-ylmethylamino)oxolan-3-ol (PubChem CID 93384643) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is (3S,4R)-4-(pyridin-4-ylmethylamino)oxolan-3-ol.
| Compound Name | (3S,4R)-4-(pyridin-4-ylmethylamino)oxolan-3-ol |
|---|---|
| PubChem CID | 93384643 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (3S,4R)-4-(pyridin-4-ylmethylamino)oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1NCc1ccncc1 |
| InChI | InChI=1S/C10H14N2O2/c13-10-7-14-6-9(10)12-5-8-1-3-11-4-2-8/h1-4,9-10,12-13H,5-7H2/t9-,10-/m1/s1 |
| InChIKey | DKSHUCDODMXORK-NXEZZACHSA-N |
| XLogP | -0.07 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |