C10H15NO3 — CID 94466425
(3S,4R)-4-[(5-methylfuran-2-yl)methylamino]oxolan-3-ol (PubChem CID 94466425) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (3S,4R)-4-[(5-methylfuran-2-yl)methylamino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[(5-methylfuran-2-yl)methylamino]oxolan-3-ol |
|---|---|
| PubChem CID | 94466425 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (3S,4R)-4-[(5-methylfuran-2-yl)methylamino]oxolan-3-ol |
| SMILES | Cc1ccc(CN[C@@H]2COC[C@H]2O)o1 |
| InChI | InChI=1S/C10H15NO3/c1-7-2-3-8(14-7)4-11-9-5-13-6-10(9)12/h2-3,9-12H,4-6H2,1H3/t9-,10-/m1/s1 |
| InChIKey | GTZHOVOXRVUTKJ-NXEZZACHSA-N |
| XLogP | 0.44 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |