C12H19NO2 — CID 115655051
[2-[(5-methylfuran-2-yl)methylamino]cyclopentyl]methanol (PubChem CID 115655051) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is [2-[(5-methylfuran-2-yl)methylamino]cyclopentyl]methanol.
| Compound Name | [2-[(5-methylfuran-2-yl)methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 115655051 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | [2-[(5-methylfuran-2-yl)methylamino]cyclopentyl]methanol |
| SMILES | Cc1ccc(CNC2CCCC2CO)o1 |
| InChI | InChI=1S/C12H19NO2/c1-9-5-6-11(15-9)7-13-12-4-2-3-10(12)8-14/h5-6,10,12-14H,2-4,7-8H2,1H3 |
| InChIKey | JDORQOCSRRNGIM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |