C11H15Br2NO2 — CID 106359455
[2-[(4,5-dibromofuran-2-yl)methylamino]cyclopentyl]methanol (PubChem CID 106359455) has the molecular formula C11H15Br2NO2 and a molecular weight of 353.05 g/mol. Its IUPAC name is [2-[(4,5-dibromofuran-2-yl)methylamino]cyclopentyl]methanol.
| Compound Name | [2-[(4,5-dibromofuran-2-yl)methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106359455 |
| Molecular Formula | C11H15Br2NO2 |
| Molecular Weight | 353.05 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | [2-[(4,5-dibromofuran-2-yl)methylamino]cyclopentyl]methanol |
| SMILES | OCC1CCCC1NCc1cc(Br)c(Br)o1 |
| InChI | InChI=1S/C11H15Br2NO2/c12-9-4-8(16-11(9)13)5-14-10-3-1-2-7(10)6-15/h4,7,10,14-15H,1-3,5-6H2 |
| InChIKey | MQVODLNABSTPIK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.05 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |