C13H21NO3 — CID 103699678
[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclohexyl]methanol (PubChem CID 103699678) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is [2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclohexyl]methanol.
| Compound Name | [2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 103699678 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclohexyl]methanol |
| SMILES | OCc1ccc(CNC2CCCCC2CO)o1 |
| InChI | InChI=1S/C13H21NO3/c15-8-10-3-1-2-4-13(10)14-7-11-5-6-12(9-16)17-11/h5-6,10,13-16H,1-4,7-9H2 |
| InChIKey | RISCEIWMRBJBCZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |