C12H19NO3 — CID 115655020
[2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclopentyl]methanol (PubChem CID 115655020) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclopentyl]methanol.
| Compound Name | [2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 115655020 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [2-[[5-(hydroxymethyl)furan-2-yl]methylamino]cyclopentyl]methanol |
| SMILES | OCc1ccc(CNC2CCCC2CO)o1 |
| InChI | InChI=1S/C12H19NO3/c14-7-9-2-1-3-12(9)13-6-10-4-5-11(8-15)16-10/h4-5,9,12-15H,1-3,6-8H2 |
| InChIKey | VLZIXRRVZZWFJK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |