C12H18BrNO2 — CID 99834074
2-[(1R,2S)-2-[(5-bromofuran-2-yl)methylamino]cyclopentyl]ethanol (PubChem CID 99834074) has the molecular formula C12H18BrNO2 and a molecular weight of 288.18 g/mol. Its IUPAC name is 2-[(1R,2S)-2-[(5-bromofuran-2-yl)methylamino]cyclopentyl]ethanol.
| Compound Name | 2-[(1R,2S)-2-[(5-bromofuran-2-yl)methylamino]cyclopentyl]ethanol |
|---|---|
| PubChem CID | 99834074 |
| Molecular Formula | C12H18BrNO2 |
| Molecular Weight | 288.18 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-[(1R,2S)-2-[(5-bromofuran-2-yl)methylamino]cyclopentyl]ethanol |
| SMILES | OCC[C@H]1CCC[C@@H]1NCc1ccc(Br)o1 |
| InChI | InChI=1S/C12H18BrNO2/c13-12-5-4-10(16-12)8-14-11-3-1-2-9(11)6-7-15/h4-5,9,11,14-15H,1-3,6-8H2/t9-,11+/m1/s1 |
| InChIKey | JNKRBWQQWXERNM-KOLCDFICSA-N |
| XLogP | 2.68 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |