C10H14BrNO — CID 103527272
N-[(5-bromofuran-2-yl)methyl]-2-ethylcyclopropan-1-amine (PubChem CID 103527272) has the molecular formula C10H14BrNO and a molecular weight of 244.13 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-2-ethylcyclopropan-1-amine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-2-ethylcyclopropan-1-amine |
|---|---|
| PubChem CID | 103527272 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-2-ethylcyclopropan-1-amine |
| SMILES | CCC1CC1NCc1ccc(Br)o1 |
| InChI | InChI=1S/C10H14BrNO/c1-2-7-5-9(7)12-6-8-3-4-10(11)13-8/h3-4,7,9,12H,2,5-6H2,1H3 |
| InChIKey | SFEVJIOMDNNYNP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |