C12H15BrF3NO — CID 43747402
N-[(5-bromofuran-2-yl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 43747402) has the molecular formula C12H15BrF3NO and a molecular weight of 326.16 g/mol. Its IUPAC name is N-[(5-bromofuran-2-yl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-[(5-bromofuran-2-yl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 43747402 |
| Molecular Formula | C12H15BrF3NO |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-[(5-bromofuran-2-yl)methyl]-3-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | FC(F)(F)C1CCCC(NCc2ccc(Br)o2)C1 |
| InChI | InChI=1S/C12H15BrF3NO/c13-11-5-4-10(18-11)7-17-9-3-1-2-8(6-9)12(14,15)16/h4-5,8-9,17H,1-3,6-7H2 |
| InChIKey | IFYMUFYGXVUBGS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |