C14H18F3NO3 — CID 104585934
methyl 5-[[[3-(trifluoromethyl)cyclohexyl]amino]methyl]furan-3-carboxylate (PubChem CID 104585934) has the molecular formula C14H18F3NO3 and a molecular weight of 305.30 g/mol. Its IUPAC name is methyl 5-[[[3-(trifluoromethyl)cyclohexyl]amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[[3-(trifluoromethyl)cyclohexyl]amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104585934 |
| Molecular Formula | C14H18F3NO3 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl 5-[[[3-(trifluoromethyl)cyclohexyl]amino]methyl]furan-3-carboxylate |
| SMILES | COC(=O)c1coc(CNC2CCCC(C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C14H18F3NO3/c1-20-13(19)9-5-12(21-8-9)7-18-11-4-2-3-10(6-11)14(15,16)17/h5,8,10-11,18H,2-4,6-7H2,1H3 |
| InChIKey | VKZRIGFYIHOXCL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |