C15H24N2O3 — CID 104586644
methyl 5-[[(1-propylpiperidin-4-yl)amino]methyl]furan-3-carboxylate (PubChem CID 104586644) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is methyl 5-[[(1-propylpiperidin-4-yl)amino]methyl]furan-3-carboxylate.
| Compound Name | methyl 5-[[(1-propylpiperidin-4-yl)amino]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 104586644 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | methyl 5-[[(1-propylpiperidin-4-yl)amino]methyl]furan-3-carboxylate |
| SMILES | CCCN1CCC(NCc2cc(C(=O)OC)co2)CC1 |
| InChI | InChI=1S/C15H24N2O3/c1-3-6-17-7-4-13(5-8-17)16-10-14-9-12(11-20-14)15(18)19-2/h9,11,13,16H,3-8,10H2,1-2H3 |
| InChIKey | SGASTKFHIAGCPZ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |