C11H15NO5S — CID 104608237
5-[[(1,1-dioxothian-4-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 104608237) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 5-[[(1,1-dioxothian-4-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[(1,1-dioxothian-4-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608237 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 5-[[(1,1-dioxothian-4-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CNC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C11H15NO5S/c13-11(14)8-5-10(17-7-8)6-12-9-1-3-18(15,16)4-2-9/h5,7,9,12H,1-4,6H2,(H,13,14) |
| InChIKey | QOEKUXUIHGBHSH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |