C14H20N2O3 — CID 104608366
5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]furan-3-carboxylic acid (PubChem CID 104608366) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]furan-3-carboxylic acid.
| Compound Name | 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608366 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 5-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CNC2CCN3CCCCC23)c1 |
| InChI | InChI=1S/C14H20N2O3/c17-14(18)10-7-11(19-9-10)8-15-12-4-6-16-5-2-1-3-13(12)16/h7,9,12-13,15H,1-6,8H2,(H,17,18) |
| InChIKey | AYAIHSZEKGKSTE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |