C15H24N2OS — CID 43783466
N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine (PubChem CID 43783466) has the molecular formula C15H24N2OS and a molecular weight of 280.44 g/mol. Its IUPAC name is N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine.
| Compound Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
|---|---|
| PubChem CID | 43783466 |
| Molecular Formula | C15H24N2OS |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-amine |
| SMILES | CSCc1ccc(CNC2CCN3CCCCC23)o1 |
| InChI | InChI=1S/C15H24N2OS/c1-19-11-13-6-5-12(18-13)10-16-14-7-9-17-8-3-2-4-15(14)17/h5-6,14-16H,2-4,7-11H2,1H3 |
| InChIKey | WVJMRPVKZVSXBF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |