C15H22N2O3 — CID 103246654
4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-5-methylfuran-2-carboxylic acid (PubChem CID 103246654) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 103246654 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-5-methylfuran-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)O)cc1CNC1CCN2CCCCC12 |
| InChI | InChI=1S/C15H22N2O3/c1-10-11(8-14(20-10)15(18)19)9-16-12-5-7-17-6-3-2-4-13(12)17/h8,12-13,16H,2-7,9H2,1H3,(H,18,19) |
| InChIKey | CYVWZWUXLIZYAP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |