C17H25N3O — CID 114480105
4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-3-methylbenzamide (PubChem CID 114480105) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-3-methylbenzamide.
| Compound Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 114480105 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 4-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-3-methylbenzamide |
| SMILES | Cc1cc(C(N)=O)ccc1CNC1CCN2CCCCC12 |
| InChI | InChI=1S/C17H25N3O/c1-12-10-13(17(18)21)5-6-14(12)11-19-15-7-9-20-8-3-2-4-16(15)20/h5-6,10,15-16,19H,2-4,7-9,11H2,1H3,(H2,18,21) |
| InChIKey | KMUNEHLERYMUON-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |