C16H24N2O2 — CID 43694220
2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-4-methoxyphenol (PubChem CID 43694220) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is 2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-4-methoxyphenol.
| Compound Name | 2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-4-methoxyphenol |
|---|---|
| PubChem CID | 43694220 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 2-[(1,2,3,5,6,7,8,8a-octahydroindolizin-1-ylamino)methyl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(CNC2CCN3CCCCC23)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-20-13-5-6-16(19)12(10-13)11-17-14-7-9-18-8-3-2-4-15(14)18/h5-6,10,14-15,17,19H,2-4,7-9,11H2,1H3 |
| InChIKey | RRZMICWWCBZJCV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|