C19H30N2O4 — CID 90273225
tert-butyl N-[(1R,2R)-2-[(2-hydroxy-5-methoxyphenyl)methylamino]cyclohexyl]carbamate (PubChem CID 90273225) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is tert-butyl N-[(1R,2R)-2-[(2-hydroxy-5-methoxyphenyl)methylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2R)-2-[(2-hydroxy-5-methoxyphenyl)methylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 90273225 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | tert-butyl N-[(1R,2R)-2-[(2-hydroxy-5-methoxyphenyl)methylamino]cyclohexyl]carbamate |
| SMILES | COc1ccc(O)c(CN[C@@H]2CCCC[C@H]2NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H30N2O4/c1-19(2,3)25-18(23)21-16-8-6-5-7-15(16)20-12-13-11-14(24-4)9-10-17(13)22/h9-11,15-16,20,22H,5-8,12H2,1-4H3,(H,21,23)/t15-,16-/m1/s1 |
| InChIKey | LCHHXRRMVUIUOV-HZPDHXFCSA-N |
| XLogP | 3.33 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|