C12H16N2O4 — CID 104608993
5-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid (PubChem CID 104608993) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 5-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid.
| Compound Name | 5-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 104608993 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 5-[[(1-methyl-6-oxopiperidin-3-yl)amino]methyl]furan-3-carboxylic acid |
| SMILES | CN1CC(NCc2cc(C(=O)O)co2)CCC1=O |
| InChI | InChI=1S/C12H16N2O4/c1-14-6-9(2-3-11(14)15)13-5-10-4-8(7-18-10)12(16)17/h4,7,9,13H,2-3,5-6H2,1H3,(H,16,17) |
| InChIKey | BFKLAZBQYHOQJE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |