C19H27NO4 — CID 157013290
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-propan-2-ylphenyl)butanamide (PubChem CID 157013290) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-propan-2-ylphenyl)butanamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-propan-2-ylphenyl)butanamide |
|---|---|
| PubChem CID | 157013290 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-propan-2-ylphenyl)butanamide |
| SMILES | CC(C)c1ccc(CCCC(=O)N[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)cc1 |
| InChI | InChI=1S/C19H27NO4/c1-12(2)14-8-6-13(7-9-14)4-3-5-17(22)20-15-10-23-19-16(21)11-24-18(15)19/h6-9,12,15-16,18-19,21H,3-5,10-11H2,1-2H3,(H,20,22)/t15-,16-,18-,19-/m1/s1 |
| InChIKey | AZLLHNPFYANDNV-PSBWJHGTSA-N |
| XLogP | 1.78 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |