C15H18ClNO4 — CID 155909570
N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-chlorophenyl)propanamide (PubChem CID 155909570) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-chlorophenyl)propanamide.
| Compound Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-chlorophenyl)propanamide |
|---|---|
| PubChem CID | 155909570 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-[(3R,3aR,6R,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-chlorophenyl)propanamide |
| SMILES | O=C(CCc1cccc(Cl)c1)N[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2O |
| InChI | InChI=1S/C15H18ClNO4/c16-10-3-1-2-9(6-10)4-5-13(19)17-11-7-20-15-12(18)8-21-14(11)15/h1-3,6,11-12,14-15,18H,4-5,7-8H2,(H,17,19)/t11-,12-,14-,15-/m1/s1 |
| InChIKey | OIWQXKQBEBHVPF-QHSBEEBCSA-N |
| XLogP | 0.92 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |