C16H27N5O2 — CID 136512774
4-(oxolan-3-ylmethyl)-N-(3-pyrazol-1-ylpropyl)piperazine-1-carboxamide (PubChem CID 136512774) has the molecular formula C16H27N5O2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 4-(oxolan-3-ylmethyl)-N-(3-pyrazol-1-ylpropyl)piperazine-1-carboxamide.
| Compound Name | 4-(oxolan-3-ylmethyl)-N-(3-pyrazol-1-ylpropyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 136512774 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | 4-(oxolan-3-ylmethyl)-N-(3-pyrazol-1-ylpropyl)piperazine-1-carboxamide |
| SMILES | O=C(NCCCn1cccn1)N1CCN(CC2CCOC2)CC1 |
| InChI | InChI=1S/C16H27N5O2/c22-16(17-4-1-6-21-7-2-5-18-21)20-10-8-19(9-11-20)13-15-3-12-23-14-15/h2,5,7,15H,1,3-4,6,8-14H2,(H,17,22) |
| InChIKey | TUGIPTQJCVIHGK-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|