C13H13FN4O3 — CID 61461761
4-fluoro-3-(2-pyrazol-1-ylethylcarbamoylamino)benzoic acid (PubChem CID 61461761) has the molecular formula C13H13FN4O3 and a molecular weight of 292.27 g/mol. Its IUPAC name is 4-fluoro-3-(2-pyrazol-1-ylethylcarbamoylamino)benzoic acid.
| Compound Name | 4-fluoro-3-(2-pyrazol-1-ylethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61461761 |
| Molecular Formula | C13H13FN4O3 |
| Molecular Weight | 292.27 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 4-fluoro-3-(2-pyrazol-1-ylethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCCn1cccn1)Nc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C13H13FN4O3/c14-10-3-2-9(12(19)20)8-11(10)17-13(21)15-5-7-18-6-1-4-16-18/h1-4,6,8H,5,7H2,(H,19,20)(H2,15,17,21) |
| InChIKey | PFRAEPHHKHKLLO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |