C17H24ClN5O3S — CID 55696278
1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-(3-pyrazol-1-ylpropyl)urea (PubChem CID 55696278) has the molecular formula C17H24ClN5O3S and a molecular weight of 413.93 g/mol. Its IUPAC name is 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-(3-pyrazol-1-ylpropyl)urea.
| Compound Name | 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-(3-pyrazol-1-ylpropyl)urea |
|---|---|
| PubChem CID | 55696278 |
| Molecular Formula | C17H24ClN5O3S |
| Molecular Weight | 413.93 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1-[2-chloro-5-(diethylsulfamoyl)phenyl]-3-(3-pyrazol-1-ylpropyl)urea |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)NCCCn2cccn2)c1 |
| InChI | InChI=1S/C17H24ClN5O3S/c1-3-23(4-2)27(25,26)14-7-8-15(18)16(13-14)21-17(24)19-9-5-11-22-12-6-10-20-22/h6-8,10,12-13H,3-5,9,11H2,1-2H3,(H2,19,21,24) |
| InChIKey | SJBVNVMTXMDOKH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.93 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|